On Target AA2AR_HUMAN 0.2905983/CHEMBL220118
For the given ligand test, we have found in our database that, being scored 0.2905983, the most similar ligand is CHEMBL220118. Check out the elaboration below.
| test (Given Ligand) | CHEMBL220118 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | Nc1nc(cc(c2ccc(F)cc2)c1C#N)C3CC3 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 0000200a 00000801 00104100 12010210 01841024 00000010 00000000 00000000 00100900 008d0850 08108004 60818800 80000880 01209000 20020000 020c000c 00420000 06001004 04a00008 00300001 40000100 0c028000 35800d81 02600018 00040000 80080080 080006c0 00000041 0040400c 00868002 00000000 20000620 |