On Target NPFF1_HUMAN 0.3/CHEMBL3361436
For the given ligand test, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL3361436. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3361436 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | NC(=N)NCC(=O)NCC1(Cc2ccc(cc2)c3ccccc3)CCN(Cc4ccccc4)CC1 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002000 01001200 00100102 04010e00 00000000 00000000 00000000 22003000 00300d40 000808c2 08300000 5003a800 0400a802 00202000 00000400 00140000 00030010 02000000 04000000 10000201 00000100 38058600 10000001 02500018 00000000 c0000000 40000000 90000040 08004110 0006000b 20044000 00000600 |