On Target CXCR4_HUMAN 0.2231405/CHEMBL364295
For the given ligand test, we have found in our database that, being scored 0.2231405, the most similar ligand is CHEMBL364295. Check out the elaboration below.
| test (Given Ligand) | CHEMBL364295 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | NC(=N)NCCC[C@@H]1NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)CC[C@@H](Cc3ccc4ccccc4c3)NC(=O)[C@@H](CCCN=C(N)N)NC1=O |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00030000 01003208 20100102 04010e00 00000002 00000000 02010000 2000200c 00200a80 000808c2 08300010 4003b000 0600901a 00202009 80000000 00140008 00000800 02000000 00002008 00020201 00000100 38250638 00000003 83500018 00000800 80000000 40130000 10000000 0c000012 0006000b a0084000 00802600 |