On Target 5HT2C_HUMAN 0.64912283/CHEMBL474950
For the given ligand test, we have found in our database that, being scored 0.64912283, the most similar ligand is CHEMBL474950. Check out the elaboration below.
| test (Given Ligand) | CHEMBL474950 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | Cl.NC[C@H]1C[C@@H]1c2cccc(c2)c3ccc(F)cc3 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00002000 01000200 00100102 02010600 00800001 00000010 00000000 00000000 00100800 000808c0 08100000 40018000 00000000 01201000 00000000 00080008 00020000 02001000 04000000 00100001 00000100 18000000 11000000 00400010 00000000 80000080 00000000 00000041 00004000 0006800a 00000000 00020600 |