On Target CCR2_HUMAN 0.4814815/CHEMBL3754334
For the given ligand test, we have found in our database that, being scored 0.4814815, the most similar ligand is CHEMBL3754334. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3754334 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2cccc(c2)c3ccccc3 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00012000 01000000 00000102 00010200 00080001 00800000 00000081 08000402 01000800 00980840 08100000 40009000 04028028 00a00000 00000400 00080008 00020000 02101020 04612018 00000801 00000100 08000a80 11008040 00400010 00201800 80000480 00404000 80000041 00004002 00020002 24020000 00000400 |