On Target MC5R_HUMAN 0.25/CHEMBL3927489
For the given ligand test, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL3927489. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3927489 (Similar Ligand) |
|---|---|
| CCCCCc2cccc(c1ccccc1)c2 | CC[C@H](CN1CC[C@H](CNC(=O)c2ccc(cc2)c3ccccc3)N[C@H](CCN4CCCCC4)C1=O)c5ccccc5 |
|
|
|
|
|
|
| 00002000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00020000 02001000 04002000 00000001 00000100 08000000 11000000 00400010 00000000 80000080 00000000 00000041 00004002 00020002 00000000 00000400 | 00022000 01003c00 00100100 44010600 00000000 00000000 00000000 2200100c 00200980 000909e0 08300000 5003b000 86008802 00002001 80000400 00000000 00020000 02000000 04000000 10000201 08000100 382e8600 10000003 8350001c 00000000 c0000000 00000000 90000040 0c004100 00060013 a0044000 00802600 |