On Target TAAR1_HUMAN 0.38125/CHEMBL1732597
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.38125, the most similar ligand is CHEMBL1732597. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL1732597 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | COc1cc(C2c3cc4c(cc3OC(NCCc3ccccc3)C2C)OCO4)cc(OC)c1OC |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000001 42000218 60100108 00010700 00001000 c2008000 42040000 21000200 04600a80 000808c0 48300000 40008040 00804002 20000000 11000001 003ea008 00000000 22088004 00480002 00020a01 00040300 18200010 01000040 83422410 40000000 e0010022 001a0000 70000000 05270380 0006800a 82000000 02012600 |