On Target GRM3_HUMAN 0.398374/CHEMBL341457
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.398374, the most similar ligand is CHEMBL341457. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL341457 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | COc1cccc(CC[C@](N)(C(=O)O)C2C[C@@H]2C(=O)O)c1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00030000 43000208 2000010a 00010600 00181000 40000000 02000000 00000000 00000800 000a08c0 08100000 4001b000 0400803a 23a00000 01000001 00080008 00000000 02000000 00482000 00020201 00000100 18000a00 03000000 00400010 00000000 80000000 00000000 00000000 00000202 0006000a 00020000 00400400 |