On Target ADRB1_HUMAN 0.45762712/CHEMBL4473518
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.45762712, the most similar ligand is CHEMBL4473518. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL4473518 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | CC(C)NC[C@H](O)COc1ccccc1CCCCCCc1ccccc1OC[C@@H](O)CNC(C)C |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000000 01000008 2010010a 00010600 00001080 82000000 02000000 00000200 00000810 00080840 08300000 40008040 00800002 00200000 01200001 00082008 10200000 22008000 00802000 00020201 00000100 18000000 07000080 08400410 00000001 c0000000 00000000 00800000 00000302 00064002 00020000 00000640 |