On Target 5HT1E_HUMAN 0.24590164/CHEMBL22744
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.24590164, the most similar ligand is CHEMBL22744. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL22744 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | NC(=O)c1ccc2[nH]cc(C3=CCC(NCCCCCCCNC4CC=C(c5c[nH]c6ccc(C(N)=O)cc56)CC4)CC3)c2c1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00000002 09008800 00100302 42810610 00041104 00000000 80082080 20001402 10500900 001828c8 08300004 41018800 88028802 00600800 00000442 00440004 00004400 02000064 00222400 00000203 41000100 1a068618 20808020 80500014 01042000 80000000 88406040 d0000000 04400002 00060c02 84060200 00002620 |