On Target DRD5_HUMAN 0.42384106/CHEMBL217299
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.42384106, the most similar ligand is CHEMBL217299. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL217299 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | Oc1cc2c(cc1O)C1c3ccccc3CNC1CO2 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04002009 42000018 20100108 10010702 000010a0 c2000000 42001400 03001200 00000880 00080840 08300000 400080c0 00800882 00200000 11001401 0008a088 90000000 02028020 00400000 00020a01 00020100 18248000 13004048 83420010 00000000 e0000001 001a4000 c0000001 06010380 00860002 22040000 02000600 |