On Target CXCR4_HUMAN 0.33333334/CHEMBL4440964
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL4440964. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL4440964 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | CCc1cccc(CNCC2CCN(Cc3ccccc3OC)CC2)c1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00000000 01000008 20100108 00010600 00001001 00000100 12000000 22001400 00200000 001808c0 08200000 50038000 00000802 00000000 01000401 00082008 00000000 02000000 00000400 00020201 00000000 18008000 00000000 00500010 00000000 c0000000 08000000 90000000 00000300 00060002 24040000 00000600 |