On Target CCKAR_HUMAN 0.25/CHEMBL250974
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL250974. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL250974 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | COc1ccc(Cn2c(CCc3ccccc3)nnc2[C@H](NC(=O)c2ccccn2)c2c[nH]c3ccccc23)c(OC)c1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 12000003 01800808 6010530a 50010e10 01041020 00180106 42846000 0e003603 80400d80 101c0840 09398124 46008840 00009806 00500000 01830441 020c210c 5002a408 06000027 00680408 00271841 c0000501 3843ae08 25802040 8144041c 00156810 c0000600 08220040 80031000 04080304 00060003 a6048280 a0004620 |