On Target HRH4_HUMAN 0.34210527/CHEMBL4063170
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.34210527, the most similar ligand is CHEMBL4063170. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL4063170 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | O=C(/C=C/c1ccccc1)c1ccc(OCCCc2c[nH]cn2)cc1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000002 00000808 20000309 00810310 04001040 02800000 82042081 00000400 01c00900 00b80840 28008000 40018800 00808002 00100800 11020003 000c200c 00000400 06100000 00418008 40020801 00000400 08020200 210080c0 00400014 01040001 82000200 00522000 40000000 00400204 00420002 c4000000 20000400 |