On Target AA3R_HUMAN 0.32222223/CHEMBL2203622
For the given ligand tetrahydrocannabinol, we have found in our database that, being scored 0.32222223, the most similar ligand is CHEMBL2203622. Check out the elaboration below.
| tetrahydrocannabinol (Given Ligand) | CHEMBL2203622 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)C3CC/C(C)=C\C23 | Cn1c2cnc1OCC/C=C\CCCCOc1ccccc1-2 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 0401c002 01000018 68000908 00010710 80081040 02000108 02000010 0008c402 00010300 00100849 80058208 40008800 02821082 00100000 51020605 821c200c 00820000 2600a000 04400000 40428001 80120140 18080000 a140a000 00408010 00240001 c0280000 70404200 80002048 00014304 10460000 d400080c 04000100 |