On Target GRM6_HUMAN 0.23321554/CHEMBL1585091
For the given ligand Trequinsin, we have found in our database that, being scored 0.23321554, the most similar ligand is CHEMBL1585091. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL1585091 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COC(=O)c1ccc(-n2c(C)cc(C(=O)CSc3ccc(NC(C)=O)cc3)c2C)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00004002 00803a00 000a0100 d0190611 00014060 4000c800 00002000 0000100c 00520100 010a48d0 00680004 60018000 80018800 00358200 020200c0 0a0c000c 04060400 82800004 08200500 00000000 c4100000 18068e20 20806001 8740001d 00042000 c0002040 08000000 048018d0 04008206 1006004b d0040200 01010220 |