On Target V1AR_HUMAN 0.3469388/CHEMBL3942564
For the given ligand Trequinsin, we have found in our database that, being scored 0.3469388, the most similar ligand is CHEMBL3942564. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3942564 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | O=c1n(Cc2cc(-c3cccc(Cl)c3Cl)ncn2)nc(-c2ccc(Cl)cc2)n1C[C@H](O)C(F)(F)F |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000e006 00800809 c4101100 00850700 a10810d0 0400e044 04c08a00 0c081001 04c00102 900209e1 0001010c 60018800 02008005 00500001 800a0000 000eb04e 08828028 8a087000 84400000 00246000 80100000 18028950 7b8030c0 0570c198 00006042 c1104600 5c048040 900c0065 1500c115 00461000 c0000e80 020203a8 |