On Target ADRB2_HUMAN 0.33992094/CHEMBL1814267
For the given ligand Trequinsin, we have found in our database that, being scored 0.33992094, the most similar ligand is CHEMBL1814267. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL1814267 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CC(=O)O.O=c1ccn(-c2cccc(CCCCOCCCCCCNC[C@H](O)c3ccc(O)c(CO)c3)c2)c(=O)[nH]1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00000062 01000208 20100102 02010700 000810c1 00004000 02008002 20001800 06400980 800808e0 ac30000c 40018000 00009802 00e00800 002c00c0 000c300c 18800008 02008000 00402400 40020201 400201a0 18208a30 23800041 81700010 02040400 c0000000 28528000 10040004 04404200 0046000a 40040000 00002680 |