On Target CCR4_HUMAN 0.30872482/CHEMBL4451802
For the given ligand Trequinsin, we have found in our database that, being scored 0.30872482, the most similar ligand is CHEMBL4451802. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL4451802 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1nn([C@H](C)c2ccc(Cl)cc2Cl)c2nc(N3CC[C@H](N4CCC[C@H]4C(=O)O)[C@H](C)C3)cnc12 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00018006 01800e08 60101100 08010630 210800c4 0800a036 0100a000 20507900 00500100 210809e0 0820000c 5001b800 86009876 01800402 808c0081 000c200c 18009808 02804004 00400000 00a60201 a0100c00 5c018b00 23800845 83500010 40046403 80100202 08078400 1000088c 0500011c 0046181a 400c5080 002226a0 |