On Target GABR1_HUMAN 0.18181819/CHEMBL392394
For the given ligand Trequinsin, we have found in our database that, being scored 0.18181819, the most similar ligand is CHEMBL392394. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL392394 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CSc1nc(NC2CCCC2)c([N+](=O)[O-])c(NC2CCCC2)n1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00014002 01000110 00180220 08182620 20000000 00006000 00009800 00100900 14000100 000000a0 00200004 40011000 04010101 00000000 00060000 000c0014 04141040 04004000 00400000 80200001 00120200 18040000 20804040 00980010 00080004 90500000 40040400 10000080 00084008 01460000 40001000 080102c0 |