On Target GASR_HUMAN 0.33576643/CHEMBL37312
For the given ligand Trequinsin, we have found in our database that, being scored 0.33576643, the most similar ligand is CHEMBL37312. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL37312 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CC(C)Oc1cccc(-n2c(CCc3c[nH]c4ccc(Br)cc34)nc3ccccc3c2=O)c1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0600400a 80008a08 20001108 50810610 000c1060 04004020 2200b802 00001000 06500980 400808e0 1910800c 40818000 08809833 0a600a00 018600c1 020c000c 08000008 06008400 00600408 00020401 40080180 18008038 21800041 91708410 00042800 c0080040 28128000 00040000 0401c204 00ce000a 40240208 680006a0 |