On Target ACM4_HUMAN 0.34117648/CHEMBL481
For the given ligand Trequinsin, we have found in our database that, being scored 0.34117648, the most similar ligand is CHEMBL481. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL481 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCc1c2c(nc3ccc(OC(=O)N4CCC(N5CCCCC5)CC4)cc13)-c1cc3c(c(=O)n1C2)COC(=O)[C@]3(O)CC |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000600a 01009e09 e1104108 50050710 00045472 0000c440 020c4800 20181040 9e500b00 700809f0 0d308004 5085d800 8d008926 00618000 a11b0041 0a1f300c 08020260 9688f004 04698002 50620201 41110628 180c8ed8 35885000 8970201c 00042402 c001aba3 081a0060 10044075 0643420d 0a060c5b c0043800 d2002620 |