On Target TAAR1_HUMAN 0.368/CHEMBL2355180
For the given ligand Trequinsin, we have found in our database that, being scored 0.368, the most similar ligand is CHEMBL2355180. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL2355180 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccccc1CCn1cnc(-c2ccc(Br)cc2)c1CC(C)C.O=C(O)C(F)(F)F |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000c002 00008209 30109108 00810610 2c0a1040 00002008 02002200 20080200 00500900 100808c0 28008008 40018880 02009012 00b00800 21030081 800c200c 10020000 86002000 04400008 40020005 80000400 18000a00 21006000 81500410 00840001 c1080201 00120200 90000040 04014305 0046000a 4008080c 28000608 |