On Target ADA1D_HUMAN 0.36290324/CHEMBL292189
For the given ligand Trequinsin, we have found in our database that, being scored 0.36290324, the most similar ligand is CHEMBL292189. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL292189 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1[nH]c(=O)n(CCCN2CCN(c3ccccc3OCC(F)(F)F)CC2)c(=O)c1C |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 05004002 00000c08 20100128 06050610 80081002 00004080 02000800 01000400 06200100 80000be0 0424000c 40018800 00809002 01f42000 012200c1 000c400c 00140000 82808000 08400400 40020200 c0100000 38000010 21c00061 02708512 00040000 c0000000 20000020 90040090 0800c205 00460010 40080804 000006a8 |