On Target CXCR3_HUMAN 0.34567901/CHEMBL272287
For the given ligand Trequinsin, we have found in our database that, being scored 0.34567901, the most similar ligand is CHEMBL272287. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL272287 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1cccc2c1n(C)c(=N)n2CC(=O)c1ccc(Br)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000400a 00008a08 68000118 00010700 000c10d0 00004004 06000000 00400008 00100300 000808c0 0900800c 4005a000 00009016 08c00000 010000c5 0c0c000c 50808000 42800408 00600000 00060000 c0000000 18020230 23800007 81400016 00000840 80008200 41120000 00000000 84000200 0046000a c0080008 08200480 |