On Target ADA2B_HUMAN 0.4279661/CHEMBL12089
For the given ligand Trequinsin, we have found in our database that, being scored 0.4279661, the most similar ligand is CHEMBL12089. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL12089 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc2cc3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.[Cl-] |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00006002 42000209 3010410a 10810600 20041020 80002000 060c0000 00080008 00300000 100808c0 48008004 40018000 01004836 20600000 21020041 0224800c 000200c0 06002004 04280000 00463200 40140200 18008018 b0805000 81400010 40802040 c0000000 00120040 30004050 05004204 0006040a 00041800 00270400 |