On Target CNR1_HUMAN 0.37699682/CHEMBL3260753
For the given ligand Trequinsin, we have found in our database that, being scored 0.37699682, the most similar ligand is CHEMBL3260753. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3260753 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCn1nc2c(-c3ccc(Cl)cc3)c(-c3cnc(C)nc3)c(=O)n(Cc3ccc(C(F)(F)F)nc3C)n2c1=O |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000a02e 40008e0d 60104180 10050610 200c5077 0000e01c 0404d401 00601000 1e500100 800008f0 0d00008c 68018800 8200d836 09e00000 20160401 820f020c 180680c8 82c8c004 04688000 40261001 c0000020 9c038178 31800843 83700518 06952c41 c0080000 48068360 90041050 0641c005 00460809 c0180024 c10287a2 |