On Target PTAFR_HUMAN 0.34920636/CHEMBL37602
For the given ligand Trequinsin, we have found in our database that, being scored 0.34920636, the most similar ligand is CHEMBL37602. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL37602 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(C2CCC(OCc3ccc(-n4c(C)nc5ccccc54)cc3)O2)cc1OC |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00000002 4b800a08 2000010a 10090700 082c1070 40004000 02048800 08001000 00300900 000818e8 0d10800c 40018000 80005802 20610200 010e0045 022c900c 08800008 02000000 10688000 00020201 c0000120 18008030 21800041 81400010 00000400 c0002040 005a8000 24000000 04000204 0046080a 40040000 02000480 |