On Target CLTR1_HUMAN 0.31060606/CHEMBL3401686
For the given ligand Trequinsin, we have found in our database that, being scored 0.31060606, the most similar ligand is CHEMBL3401686. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3401686 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | O=C(O)CCCN1CC(C(=O)O)Oc2c(OCc3ccc(OCCCCc4ccccc4)cc3)cccc21 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 04026002 81000008 2010110a 00210702 a0181080 06006000 02040000 20000000 00060920 000808c0 08340004 5001d000 0c80c002 08210000 112a1041 0208e008 10840080 82000000 08c00010 00022601 41100100 18040a20 37400080 08c09010 00001001 80002000 28420008 10800081 00008200 0006000a 40000400 00822f80 |