On Target ACM3_HUMAN 0.3265306/CHEMBL3645319
For the given ligand Trequinsin, we have found in our database that, being scored 0.3265306, the most similar ligand is CHEMBL3645319. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3645319 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(CC(=O)Nc2cccc(N(C)C(=O)CCN3CCC(OC(=O)Nc4ccccc4-c4ccccc4)CC3)c2)cc1CC(C)NC[C@H](O)c1ccc(O)c2[nH]c(=O)ccc12 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00006002 01400c08 60104108 40010600 28041081 0000c064 02040801 20280200 06400b84 400809e0 0c380104 500190c0 99008802 00700100 411a0041 001c200c 90268000 02802000 0ca00810 00620201 60100100 18208e38 33802082 81501411 00083401 c0101002 00520450 108050d0 0480c300 81061017 40042880 00002620 |