On Target GRM3_HUMAN 0.3125/CHEMBL3401177
For the given ligand Trequinsin, we have found in our database that, being scored 0.3125, the most similar ligand is CHEMBL3401177. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3401177 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | O=c1n(-c2ccc(F)cc2)ccc2nc(COc3ccccc3)cn12 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0400002a 00801a08 221a4008 12000610 00081060 0000c050 02009002 00001400 14400300 000408e0 0d00800c 40008800 00809802 00111000 012e04c1 080c000c 0c008008 03800000 00410000 40220000 40000080 18008040 a1800843 81201504 00040000 c0008000 28008000 00000001 04004204 00468008 c0040004 00000680 |