On Target DRD3_HUMAN 0.38686132/CHEMBL4096422
For the given ligand Trequinsin, we have found in our database that, being scored 0.38686132, the most similar ligand is CHEMBL4096422. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL4096422 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CN(CCCCOc1ccc2c(c1)NC(=O)CC2)[C@@H]1Cc2cccc3[nH]c(=O)n(c23)C1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 04004002 80000e08 20101108 41850710 301c1040 06006140 02042000 20000000 04700981 800908e0 2d38902c 40019000 1c809002 09d00800 113208c1 000c200c 00048080 82000000 08600008 40022601 c0100100 38200630 21802001 93600414 0c042800 c1000000 00120250 10001090 8c008200 0046001b 40080000 20022ea0 |