On Target ADRB1_HUMAN 0.34615386/CHEMBL467298
For the given ligand Trequinsin, we have found in our database that, being scored 0.34615386, the most similar ligand is CHEMBL467298. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL467298 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | O=C(Cc1nc2ccccc2n1Cc1ccccc1)Nc1ccc(CCNC[C@H](O)COc2ccccc2)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0400400a 00800a08 20100528 50010600 200c10e0 02004000 02000000 00001000 80100180 10081ac0 0928800c 40819000 02809802 00508000 812a00c1 020c200c 10240000 0a000000 08e82000 00030200 c0100000 18208630 278020c1 8b400410 00001001 c0000080 10000000 00800080 04008204 0046080b 400c5000 200026c0 |