On Target 5HT1E_HUMAN 0.25925925/CHEMBL4210782
For the given ligand Trequinsin, we have found in our database that, being scored 0.25925925, the most similar ligand is CHEMBL4210782. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL4210782 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1ccc(-c2n[nH]c3c2CCNCC3)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 04002000 42000009 a0100180 01010610 01001020 80000002 00402000 00000201 00000180 000c0840 00208000 6080a080 10000012 00200000 21000800 000c200c 80020200 0a101000 04400000 10220240 00000000 1a602000 10804800 11404018 00802000 80000080 10120000 00000061 04004004 00060402 00000200 00002222 |