On Target GRM1_HUMAN 0.31751823/CHEMBL246609
For the given ligand Trequinsin, we have found in our database that, being scored 0.31751823, the most similar ligand is CHEMBL246609. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL246609 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1nc2c(cnn2-c2ccccc2)c(=O)n1N1CCCCCC1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00000006 01000e08 60100000 10000600 801800e0 0001c004 08819804 20863c00 06c84160 800108e0 0120000c 40018800 40009c06 00400000 000e00c0 000c000c 18008810 00808000 00402000 80220201 c0000100 1c018070 63800843 83500014 02012801 80000200 64018000 100c0800 0c004005 004e0018 c00c0000 c0002ea0 |