On Target AGTR2_HUMAN 0.34432235/CHEMBL2435821
For the given ligand Trequinsin, we have found in our database that, being scored 0.34432235, the most similar ligand is CHEMBL2435821. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL2435821 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCCc1nc2c(C)cc(C(=O)NCCCN3CCOCC3)cc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0800a00a 00809e01 00101500 90050610 000c00e1 0000c000 10000000 02001004 80500100 100019f0 0120800c 40818800 82009882 00608000 200b14c8 0a0c010c 10020008 06800004 04680008 50010201 c0000000 180e8e30 33800041 8150041c 00044400 c0000000 08000040 80000041 04404304 00c60819 e00c8004 200006a0 |