On Target AA2AR_HUMAN 0.43866172/CHEMBL260179
For the given ligand Trequinsin, we have found in our database that, being scored 0.43866172, the most similar ligand is CHEMBL260179. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL260179 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(C2CCN(C(=O)COc3ccc(-c4cc5c([nH]4)c(=O)n(C)c(=O)n5C)cc3OC)CC2)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0400202a 41801a08 20100108 12a50602 000c10e0 0000e040 02048002 20080000 16440900 d00818e0 0d34000c 7001c000 0080d832 00e01000 013e10c1 020c800c 18820040 8280a004 04680000 00623203 c0000180 38068670 b3800041 00700018 00040000 c0000000 20128048 10040051 00004204 00460c0b 40081a00 000006a0 |