On Target DRD1_HUMAN 0.44061303/CHEMBL3697612
For the given ligand Trequinsin, we have found in our database that, being scored 0.44061303, the most similar ligand is CHEMBL3697612. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3697612 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1cc(Oc2ncccc2C(F)F)ccc1-c1c(C)c(=O)[nH]c(=O)n1C1CC1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000e002 40000819 20104108 02050610 a00c1002 00016140 06044c00 00480400 06000104 800008f0 0c00800c 60018800 03009832 03f00000 a1220181 001c220e 10060020 8200a004 04682000 40220200 d5520000 18028010 b1802041 00720518 00040002 c0000000 28020020 90240050 004043a4 00460004 401a0c04 040002a0 |