On Target DRD5_HUMAN 0.4067164/CHEMBL3697578
For the given ligand Trequinsin, we have found in our database that, being scored 0.4067164, the most similar ligand is CHEMBL3697578. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3697578 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1cc(Oc2ncccc2OC(F)F)ccc1-c1c(C)c(=O)[nH]c(=O)n1C |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000e002 40000819 60104108 02050610 800c1012 00014104 060c4c00 00680400 06100100 801008f0 0c00800c 60c48800 0300d836 08700000 a1220181 001c820d 10060020 8200a000 04682000 40220200 45520000 18028100 31802049 00708508 00042502 c0000000 20020020 d0240050 020042a4 0046000c 40000c04 040002a0 |