On Target NPY1R_HUMAN 0.33992094/CHEMBL145663
For the given ligand Trequinsin, we have found in our database that, being scored 0.33992094, the most similar ligand is CHEMBL145663. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL145663 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCOC(=O)CN1CCC(CCCn2c(COc3ccc(Cl)cc3)nc3c(C)cccc32)CC1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 04008002 01000808 22120108 90050610 000c50e0 0000c040 02000000 20000000 00000300 000018d0 0120800c 5001a800 02809006 00c08000 810a10c9 020e000c 14028000 02880400 00602000 40020201 c0000000 18000b70 b3800007 00500110 00042400 c0000020 00100040 10000001 00000204 00460800 c0084004 000202a0 |