On Target GRM2_HUMAN 0.39694658/CHEMBL3921665
For the given ligand Trequinsin, we have found in our database that, being scored 0.39694658, the most similar ligand is CHEMBL3921665. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL3921665 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCC(O)(c1cn(Cc2ccc3c(-c4ccc(OC)c(OC)c4)cc(C(N)=O)nc3c2)cn1)C(F)(F)F |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00002002 40801a08 20104108 10810618 040c1061 04008440 02042000 00001001 00400b00 800c08c0 2009800c 60008800 8000d832 00708800 010200c1 0a0c800c 00028048 87009000 04680008 40021201 c0000400 18028648 31802044 8150001c 02144000 80000200 08020060 90040041 14004205 00460009 c00c1000 20004628 |