On Target CNR2_HUMAN 0.35915494/CHEMBL495756
For the given ligand Trequinsin, we have found in our database that, being scored 0.35915494, the most similar ligand is CHEMBL495756. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL495756 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCCCSc1nc2c(c(=O)n1CCc1ccccc1)C1(CCCC1)Cc1ccccc1-2 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000a002 01002a01 000009a2 00952618 010a0102 00016000 00002300 10080408 06520900 804848e2 2810800c 60018800 03019000 00f40880 a00210a0 080c0604 04060000 8681a000 04402021 42200811 80280100 1c120010 31c06941 8978011c 32840000 90000001 20000020 100440c0 04004007 0546000e 400a0804 010105f8 |