On Target CCKAR_HUMAN 0.33579335/CHEMBL1773889
For the given ligand Trequinsin, we have found in our database that, being scored 0.33579335, the most similar ligand is CHEMBL1773889. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL1773889 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(-c2cnc(C(=O)N3CCN(c4cnc5ccccc5c4)CC3)nc2-c2ccc(C)cc2)cc1OC |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000e002 40802809 20004128 14050e30 04041020 0810402a 02441000 00082049 00000100 00000a50 00298084 60008800 0200c812 0870a000 21020041 800c810c 00060080 0200202a 0c680000 50021204 40100000 28028608 30802060 8240010a 00140003 80180000 00020610 000010c0 0801c204 01660009 40441820 000042a0 |