On Target OPRX_HUMAN 0.34322035/CHEMBL480425
For the given ligand Trequinsin, we have found in our database that, being scored 0.34322035, the most similar ligand is CHEMBL480425. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL480425 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CC1(N2CCC(n3c(-c4cccc(OCCO)c4)nc4ccccc43)CC2)CCCCCCC1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 04004002 41000408 20100108 10810600 200c1060 00006000 02000000 20080000 00200100 100019c0 0120800c 50018000 00801002 01c40080 012200c1 020c000c 00100080 02002000 00682000 00422201 c0100000 38000030 a5800001 08500010 00000000 c0000000 00000004 10800000 00000204 00460c10 400a0800 00002280 |