On Target GRM8_HUMAN 0.3057554/CHEMBL4446107
For the given ligand Trequinsin, we have found in our database that, being scored 0.3057554, the most similar ligand is CHEMBL4446107. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL4446107 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCc1nn2c(C(F)(F)F)cc(C)nc2c1-c1cc(F)c(OC)cc1F |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00000022 40000809 60100188 5a050610 01005024 0400401e 02841400 00200e00 04006100 010ca870 0c108004 52018802 80008816 08309000 21120801 800c200c 00268a40 02800000 04400000 00a21040 00000000 2c40a200 20804840 80400110 00942401 c1080000 28120200 90000851 00004204 00428003 402000b0 000052a0 |