On Target ACM2_HUMAN 0.32258064/CHEMBL296419
For the given ligand Trequinsin, we have found in our database that, being scored 0.32258064, the most similar ligand is CHEMBL296419. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL296419 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1ccc(CCN2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)cc1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00000006 01800608 20100108 02010600 000c1040 00004012 02048000 20101000 00100190 200809e0 0920800c 50018000 00001802 00401000 012000c1 000c000c 00000000 02004100 00600000 00b20201 c0000000 5c208030 21800841 81700010 00000000 80000000 02128000 10000001 05000218 0046981a 400c1000 00002680 |