On Target BKRB2_HUMAN 0.32993197/CHEMBL559436
For the given ligand Trequinsin, we have found in our database that, being scored 0.32993197, the most similar ligand is CHEMBL559436. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL559436 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | Cc1cc(-c2ccnn2C)c2cccc(OCc3c(Cl)cncc3Cn3cccc(C(F)(F)F)c3=O)c2n1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0400e006 08008a08 e2104108 10010610 010c1022 04008046 02c44c00 00621000 0e500100 400008f0 05008004 60058800 86c0883a 0a618000 81120041 020c200c 00021121 8200d004 0c608008 00220000 40101000 18038118 30880800 83f0d018 00040c02 c0084602 18020240 90040061 06404205 00060048 40340600 c0020220 |