On Target 5HT4R_HUMAN 0.30337077/CHEMBL571799
For the given ligand Trequinsin, we have found in our database that, being scored 0.30337077, the most similar ligand is CHEMBL571799. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL571799 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | COc1cccc([C@]2(O)CCCC[C@H]2CN2CC[C@@H](NC(=O)c3cc(Cl)c(N)cc3OC)[C@@H](OC)C2)c1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 0000800a cb005e08 2010010a 80010700 00181080 40024100 06000000 22001400 00000900 001809e8 08300004 50018800 02008806 28a00000 81081445 000c2008 10000000 02000400 02c82000 00020601 40000100 180a8730 33000080 0050001c 00002001 c0000400 00900a00 90000001 00000302 0006081b e4060000 00022e00 |