On Target CXCR2_HUMAN 0.33557048/CHEMBL207742
For the given ligand Trequinsin, we have found in our database that, being scored 0.33557048, the most similar ligand is CHEMBL207742. Check out the elaboration below.
| Trequinsin (Given Ligand) | CHEMBL207742 (Similar Ligand) |
|---|---|
| COc4cc3CCn2c(cc(=Nc1c(C)cc(C)cc1C)n(C)c2=O)c3cc4OC | CCCCc1cc(N[C@@H](CC(C)C)C(=O)NCCCOCC)nc(-n2cnc(-c3ccc(OC)cc3)c2)n1 |
|
|
|
|
|
|
| 0000e042 42000e09 3410118a 01c50700 200810a1 84016000 02055a00 00080000 05900300 800808e0 0c00800c 60018800 0300d033 68f00000 912a00c9 020cc00c 108208e0 07902000 04494000 00023200 e0100000 18030010 b3806145 93600118 028a0002 c8808000 48130000 10004151 0c0c4215 0146041a 40181800 00000ca4 | 00018002 01001809 6010112a 4c0d0610 670010cc 0000600a 0384a200 20180b00 00400900 000c0ad0 0032800c 4001b800 0f009033 00382900 01420001 801c000c 00268800 86806000 04c00008 40220241 84100420 3e140600 a58068c1 0250011e 00142401 80080280 08020200 100000c0 0801421d 00460003 40007880 200062e0 |