On Target GRM6_HUMAN 0.30869564/CHEMBL1585091
For the given ligand chenyan1, we have found in our database that, being scored 0.30869564, the most similar ligand is CHEMBL1585091. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL1585091 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | COC(=O)c1ccc(cc1)n2c(C)cc(C(=O)CSc3ccc(NC(=O)C)cc3)c2C |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 00004002 00803a00 000a0100 d0190611 00014060 4000c800 00002000 0000100c 00520100 010a48d0 00680004 60018000 80018800 00358200 020200c0 0a0c000c 04060400 82800004 08200500 00000000 c4100000 18068e20 20806001 8740001d 00042000 c0002040 08000000 048018d0 04008206 1006004b d0040200 01010220 |